C32H44N4O4 — CID 158926814
tert-butyl N-amino-N-benzylcarbamate;tert-butyl N-benzyl-N-(2,3-dimethylanilino)carbamate (PubChem CID 158926814) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is tert-butyl N-amino-N-benzylcarbamate;tert-butyl N-benzyl-N-(2,3-dimethylanilino)carbamate.
| Compound Name | tert-butyl N-amino-N-benzylcarbamate;tert-butyl N-benzyl-N-(2,3-dimethylanilino)carbamate |
|---|---|
| PubChem CID | 158926814 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | tert-butyl N-amino-N-benzylcarbamate;tert-butyl N-benzyl-N-(2,3-dimethylanilino)carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)Cc1ccccc1.Cc1cccc(NN(Cc2ccccc2)C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C20H26N2O2.C12H18N2O2/c1-15-10-9-13-18(16(15)2)21-22(19(23)24-20(3,4)5)14-17-11-7-6-8-12-17;1-12(2,3)16-11(15)14(13)9-10-7-5-4-6-8-10/h6-13,21H,14H2,1-5H3;4-8H,9,13H2,1-3H3 |
| InChIKey | JINWYOYOVITFLT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|