C20H25NO3S — CID 54012842
tert-butyl N-benzyl-N-[(2R)-2-methyl-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate (PubChem CID 54012842) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(2R)-2-methyl-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(2R)-2-methyl-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 54012842 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | tert-butyl N-benzyl-N-[(2R)-2-methyl-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1)[C@@](C)(C=O)Cc1cccs1 |
| InChI | InChI=1S/C20H25NO3S/c1-19(2,3)24-18(23)21(14-16-9-6-5-7-10-16)20(4,15-22)13-17-11-8-12-25-17/h5-12,15H,13-14H2,1-4H3/t20-/m1/s1 |
| InChIKey | KTOPLDLWGOKHFS-HXUWFJFHSA-N |
| XLogP | 4.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|