C18H26N2O2 — CID 82124732
tert-butyl N-[(4-tert-butylphenyl)-cyanomethyl]-N-methylcarbamate (PubChem CID 82124732) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl N-[(4-tert-butylphenyl)-cyanomethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(4-tert-butylphenyl)-cyanomethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 82124732 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl N-[(4-tert-butylphenyl)-cyanomethyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,3)14-10-8-13(9-11-14)15(12-19)20(7)16(21)22-18(4,5)6/h8-11,15H,1-7H3 |
| InChIKey | UJQMBOWQTMVGLM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |