C21H27NO3 — CID 67725390
tert-butyl N-(1-hydroxy-2,2-diphenylpropyl)-N-methylcarbamate (PubChem CID 67725390) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-2,2-diphenylpropyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(1-hydroxy-2,2-diphenylpropyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 67725390 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | tert-butyl N-(1-hydroxy-2,2-diphenylpropyl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-20(2,3)25-19(24)22(5)18(23)21(4,16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15,18,23H,1-5H3 |
| InChIKey | QLULKAMLRYLDOX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|