C17H26N2O3 — CID 10494880
tert-butyl N-[(2R)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]-N-methylcarbamate (PubChem CID 10494880) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2R)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10494880 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl N-[(2R)-1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]-N-methylcarbamate |
| SMILES | CCNC(=O)[C@@H](Cc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-6-18-15(20)14(12-13-10-8-7-9-11-13)19(5)16(21)22-17(2,3)4/h7-11,14H,6,12H2,1-5H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | JOGBUAWWKCIIRH-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |