C20H32N2O3S — CID 54376676
tert-butyl N-methyl-N-[(2S)-1-oxo-3-phenyl-1-(2-propylsulfanylethylamino)propan-2-yl]carbamate (PubChem CID 54376676) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(2S)-1-oxo-3-phenyl-1-(2-propylsulfanylethylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(2S)-1-oxo-3-phenyl-1-(2-propylsulfanylethylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 54376676 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | tert-butyl N-methyl-N-[(2S)-1-oxo-3-phenyl-1-(2-propylsulfanylethylamino)propan-2-yl]carbamate |
| SMILES | CCCSCCNC(=O)[C@H](Cc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O3S/c1-6-13-26-14-12-21-18(23)17(15-16-10-8-7-9-11-16)22(5)19(24)25-20(2,3)4/h7-11,17H,6,12-15H2,1-5H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | UWZPVTZGAKFXSZ-KRWDZBQOSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|