C16H32N2O5Si — CID 150950149
[1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-en-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid (PubChem CID 150950149) has the molecular formula C16H32N2O5Si and a molecular weight of 360.53 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-en-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-en-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 150950149 |
| Molecular Formula | C16H32N2O5Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-3-en-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid |
| SMILES | C=C(C)C(CO[Si](C)(C)C(C)(C)C)N(CC(=O)N(C)OC)C(=O)O |
| InChI | InChI=1S/C16H32N2O5Si/c1-12(2)13(11-23-24(8,9)16(3,4)5)18(15(20)21)10-14(19)17(6)22-7/h13H,1,10-11H2,2-9H3,(H,20,21) |
| InChIKey | LJXOBCMVBAXDIN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|