C28H55NO5Si2 — CID 131735302
tert-butyl N-[(2S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-N-[(E)-2-oxopent-3-enyl]carbamate (PubChem CID 131735302) has the molecular formula C28H55NO5Si2 and a molecular weight of 541.92 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-N-[(E)-2-oxopent-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-N-[(E)-2-oxopent-3-enyl]carbamate |
|---|---|
| PubChem CID | 131735302 |
| Molecular Formula | C28H55NO5Si2 |
| Molecular Weight | 541.92 g/mol |
| Exact Mass | 541.36 |
| IUPAC Name | tert-butyl N-[(2S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-N-[(E)-2-oxopent-3-enyl]carbamate |
| SMILES | C=C(CCO[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N(CC(=O)/C=C/C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H55NO5Si2/c1-16-17-23(30)20-29(25(31)34-26(3,4)5)24(21-33-36(14,15)28(9,10)11)22(2)18-19-32-35(12,13)27(6,7)8/h16-17,24H,2,18-21H2,1,3-15H3/b17-16+/t24-/m1/s1 |
| InChIKey | APGPJPHSZPEWPQ-GQRCBVMOSA-N |
| XLogP | 7.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.92 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|