C23H48N2O6Si2 — CID 151226329
[1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid (PubChem CID 151226329) has the molecular formula C23H48N2O6Si2 and a molecular weight of 504.82 g/mol. Its IUPAC name is [1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid.
| Compound Name | [1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 151226329 |
| Molecular Formula | C23H48N2O6Si2 |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylidenepentan-2-yl]-[2-[methoxy(methyl)amino]-2-oxoethyl]carbamic acid |
| SMILES | C=C(CCO[Si](C)(C)C(C)(C)C)C(CO[Si](C)(C)C(C)(C)C)N(CC(=O)N(C)OC)C(=O)O |
| InChI | InChI=1S/C23H48N2O6Si2/c1-18(14-15-30-32(10,11)22(2,3)4)19(17-31-33(12,13)23(5,6)7)25(21(27)28)16-20(26)24(8)29-9/h19H,1,14-17H2,2-13H3,(H,27,28) |
| InChIKey | NNISRDAVLBUDAV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|