C22H40O2Si2 — CID 10905275
tert-butyl-(1-cyclohexyloxy-7-trimethylsilylhepta-1,6-diyn-4-yl)oxy-dimethylsilane (PubChem CID 10905275) has the molecular formula C22H40O2Si2 and a molecular weight of 392.73 g/mol. Its IUPAC name is tert-butyl-(1-cyclohexyloxy-7-trimethylsilylhepta-1,6-diyn-4-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(1-cyclohexyloxy-7-trimethylsilylhepta-1,6-diyn-4-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 10905275 |
| Molecular Formula | C22H40O2Si2 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | tert-butyl-(1-cyclohexyloxy-7-trimethylsilylhepta-1,6-diyn-4-yl)oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC#COC1CCCCC1)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C22H40O2Si2/c1-22(2,3)26(7,8)24-21(17-13-19-25(4,5)6)16-12-18-23-20-14-10-9-11-15-20/h20-21H,9-11,14-17H2,1-8H3 |
| InChIKey | SVXKOJBCQZHZKU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|