C22H43NO2Si2 — CID 56641975
(E,3R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-N,N,3,6-tetramethyl-9-trimethylsilylnon-4-en-8-ynamide (PubChem CID 56641975) has the molecular formula C22H43NO2Si2 and a molecular weight of 409.76 g/mol. Its IUPAC name is (E,3R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-N,N,3,6-tetramethyl-9-trimethylsilylnon-4-en-8-ynamide.
| Compound Name | (E,3R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-N,N,3,6-tetramethyl-9-trimethylsilylnon-4-en-8-ynamide |
|---|---|
| PubChem CID | 56641975 |
| Molecular Formula | C22H43NO2Si2 |
| Molecular Weight | 409.76 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (E,3R,6S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-N,N,3,6-tetramethyl-9-trimethylsilylnon-4-en-8-ynamide |
| SMILES | C[C@@H](/C=C/[C@H](C)[C@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)CC(=O)N(C)C |
| InChI | InChI=1S/C22H43NO2Si2/c1-18(17-21(24)23(6)7)13-14-19(2)20(15-16-26(8,9)10)25-27(11,12)22(3,4)5/h13-14,18-20H,17H2,1-12H3/b14-13+/t18-,19-,20-/m0/s1 |
| InChIKey | AJINIKNWNZHYGU-RKJGVCGYSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|