C22H42O7Si — CID 87261833
dimethyl (Z)-2-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxydecyl]but-2-enedioate (PubChem CID 87261833) has the molecular formula C22H42O7Si and a molecular weight of 446.66 g/mol. Its IUPAC name is dimethyl (Z)-2-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxydecyl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxydecyl]but-2-enedioate |
|---|---|
| PubChem CID | 87261833 |
| Molecular Formula | C22H42O7Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | dimethyl (Z)-2-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxydecyl]but-2-enedioate |
| SMILES | CCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C22H42O7Si/c1-9-10-11-12-13-14-17(29-30(7,8)22(2,3)4)20(25)19(24)16(21(26)28-6)15-18(23)27-5/h15,17,19-20,24-25H,9-14H2,1-8H3/b16-15-/t17-,19+,20+/m0/s1 |
| InChIKey | OYMAQCVESVXJMF-ZZQIEMEBSA-N |
| XLogP | 3.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|