C21H39IO3Si — CID 135015261
methyl (2E,4Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-iodotetradeca-2,4-dienoate (PubChem CID 135015261) has the molecular formula C21H39IO3Si and a molecular weight of 494.53 g/mol. Its IUPAC name is methyl (2E,4Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-iodotetradeca-2,4-dienoate.
| Compound Name | methyl (2E,4Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-iodotetradeca-2,4-dienoate |
|---|---|
| PubChem CID | 135015261 |
| Molecular Formula | C21H39IO3Si |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | methyl (2E,4Z,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-iodotetradeca-2,4-dienoate |
| SMILES | CCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)/C(I)=C/C=C/C(=O)OC |
| InChI | InChI=1S/C21H39IO3Si/c1-8-9-10-11-12-13-16-19(25-26(6,7)21(2,3)4)18(22)15-14-17-20(23)24-5/h14-15,17,19H,8-13,16H2,1-7H3/b17-14+,18-15-/t19-/m1/s1 |
| InChIKey | WZXQSYJOUREYCL-DIKFBDGYSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|