C22H36O7Si — CID 10836852
4-O-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate (PubChem CID 10836852) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is 4-O-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate.
| Compound Name | 4-O-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 10836852 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 4-O-[(1S,2E,4E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-2,4-dienyl] 1-O-methyl (Z)-but-2-enedioate |
| SMILES | COC(=O)/C=C\C(=O)O[C@@H](/C=C/C=C/CO[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H36O7Si/c1-21(2,3)30(7,8)27-15-11-9-10-12-17(18-16-26-22(4,5)29-18)28-20(24)14-13-19(23)25-6/h9-14,17-18H,15-16H2,1-8H3/b11-9+,12-10+,14-13-/t17-,18+/m0/s1 |
| InChIKey | OZHYEFIJOKQBKY-CXJUQGSTSA-N |
| XLogP | 3.91 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|