C20H38O3Si — CID 135016412
(2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylheptyl]-2,3-dihydropyran-6-one (PubChem CID 135016412) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylheptyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylheptyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 135016412 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (2R)-2-[(1S,2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethylheptyl]-2,3-dihydropyran-6-one |
| SMILES | CCCC[C@H](C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C20H38O3Si/c1-9-10-12-15(2)16(3)19(17-13-11-14-18(21)22-17)23-24(7,8)20(4,5)6/h11,14-17,19H,9-10,12-13H2,1-8H3/t15-,16+,17+,19-/m0/s1 |
| InChIKey | SSPAFTIZAQTRPH-FAJBIJEISA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|