C28H52O3Si — CID 54325031
1-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]trideca-1,3-dien-5-yl acetate (PubChem CID 54325031) has the molecular formula C28H52O3Si and a molecular weight of 464.81 g/mol. Its IUPAC name is 1-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]trideca-1,3-dien-5-yl acetate.
| Compound Name | 1-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]trideca-1,3-dien-5-yl acetate |
|---|---|
| PubChem CID | 54325031 |
| Molecular Formula | C28H52O3Si |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | 1-[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]trideca-1,3-dien-5-yl acetate |
| SMILES | CCCCCCCCC(C=CC=CC1(CO[Si](C)(C)C(C)(C)C)CCCCC1)OC(C)=O |
| InChI | InChI=1S/C28H52O3Si/c1-8-9-10-11-12-14-19-26(31-25(2)29)20-15-18-23-28(21-16-13-17-22-28)24-30-32(6,7)27(3,4)5/h15,18,20,23,26H,8-14,16-17,19,21-22,24H2,1-7H3 |
| InChIKey | SUHRDBOYXDOEAU-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|