C27H50O3Si — CID 138965235
butyl (2E,4E)-7-cyclohexyl-5-methyl-7-tri(propan-2-yl)silyloxyhepta-2,4-dienoate (PubChem CID 138965235) has the molecular formula C27H50O3Si and a molecular weight of 450.78 g/mol. Its IUPAC name is butyl (2E,4E)-7-cyclohexyl-5-methyl-7-tri(propan-2-yl)silyloxyhepta-2,4-dienoate.
| Compound Name | butyl (2E,4E)-7-cyclohexyl-5-methyl-7-tri(propan-2-yl)silyloxyhepta-2,4-dienoate |
|---|---|
| PubChem CID | 138965235 |
| Molecular Formula | C27H50O3Si |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | butyl (2E,4E)-7-cyclohexyl-5-methyl-7-tri(propan-2-yl)silyloxyhepta-2,4-dienoate |
| SMILES | CCCCOC(=O)/C=C/C=C(\C)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C27H50O3Si/c1-9-10-19-29-27(28)18-14-15-24(8)20-26(25-16-12-11-13-17-25)30-31(21(2)3,22(4)5)23(6)7/h14-15,18,21-23,25-26H,9-13,16-17,19-20H2,1-8H3/b18-14+,24-15+ |
| InChIKey | NBTRDIQCCYCRSZ-FNCHSGSASA-N |
| XLogP | 8.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|