C20H37BrO2Si — CID 68712387
2-[2-[4-(bromomethyl)-2-methylpent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 68712387) has the molecular formula C20H37BrO2Si and a molecular weight of 417.50 g/mol. Its IUPAC name is 2-[2-[4-(bromomethyl)-2-methylpent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[2-[4-(bromomethyl)-2-methylpent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 68712387 |
| Molecular Formula | C20H37BrO2Si |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[2-[4-(bromomethyl)-2-methylpent-4-enyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | C=C(CBr)CC(C)CC1CC=CC(CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H37BrO2Si/c1-16(13-17(2)15-21)14-19-10-8-9-18(23-19)11-12-22-24(6,7)20(3,4)5/h8-9,16,18-19H,2,10-15H2,1,3-7H3 |
| InChIKey | DDXNZUQJXUHJSM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|