C23H38O3Si — CID 25111514
(2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-methylidene-7-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]heptanal (PubChem CID 25111514) has the molecular formula C23H38O3Si and a molecular weight of 390.64 g/mol. Its IUPAC name is (2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-methylidene-7-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]heptanal.
| Compound Name | (2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-methylidene-7-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]heptanal |
|---|---|
| PubChem CID | 25111514 |
| Molecular Formula | C23H38O3Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-methyl-4-methylidene-7-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]heptanal |
| SMILES | C#CC[C@@H]1C=CC[C@@H](C[C@@H](C)CC(=C)C[C@@H](C=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H38O3Si/c1-9-11-20-12-10-13-21(25-20)15-18(2)14-19(3)16-22(17-24)26-27(7,8)23(4,5)6/h1,10,12,17-18,20-22H,3,11,13-16H2,2,4-8H3/t18-,20+,21-,22-/m0/s1 |
| InChIKey | AHKPQSYJZZSIHR-FKVLARQCSA-N |
| XLogP | 5.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|