C24H44O5Si — CID 11189904
(2S,6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal (PubChem CID 11189904) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is (2S,6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal.
| Compound Name | (2S,6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal |
|---|---|
| PubChem CID | 11189904 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (2S,6S)-7-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-2-(methoxymethoxy)-6-methyl-4-methylideneheptanal |
| SMILES | C=C(C[C@H](C)C[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1)C[C@@H](C=O)OCOC |
| InChI | InChI=1S/C24H44O5Si/c1-19(14-20(2)16-23(17-25)27-18-26-6)15-22-11-9-10-21(29-22)12-13-28-30(7,8)24(3,4)5/h9-10,17,19,21-23H,2,11-16,18H2,1,3-8H3/t19-,21-,22-,23-/m0/s1 |
| InChIKey | QBWOIEIZSXKEFI-UDIDDNNKSA-N |
| XLogP | 5.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|