C30H54O5Si — CID 10864294
(2R,5S,7S,8E,10E,12E,14S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-7,18-dimethoxy-2,8,14,16-tetramethyl-17-oxooctadeca-8,10,12-trienal (PubChem CID 10864294) has the molecular formula C30H54O5Si and a molecular weight of 522.84 g/mol. Its IUPAC name is (2R,5S,7S,8E,10E,12E,14S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-7,18-dimethoxy-2,8,14,16-tetramethyl-17-oxooctadeca-8,10,12-trienal.
| Compound Name | (2R,5S,7S,8E,10E,12E,14S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-7,18-dimethoxy-2,8,14,16-tetramethyl-17-oxooctadeca-8,10,12-trienal |
|---|---|
| PubChem CID | 10864294 |
| Molecular Formula | C30H54O5Si |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | (2R,5S,7S,8E,10E,12E,14S,16R)-5-[tert-butyl(dimethyl)silyl]oxy-7,18-dimethoxy-2,8,14,16-tetramethyl-17-oxooctadeca-8,10,12-trienal |
| SMILES | COCC(=O)[C@H](C)C[C@H](C)/C=C/C=C/C=C(\C)[C@H](C[C@H](CC[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C30H54O5Si/c1-23(19-26(4)28(32)22-33-8)15-13-12-14-16-25(3)29(34-9)20-27(18-17-24(2)21-31)35-36(10,11)30(5,6)7/h12-16,21,23-24,26-27,29H,17-20,22H2,1-11H3/b14-12+,15-13+,25-16+/t23-,24-,26-,27+,29+/m1/s1 |
| InChIKey | ZVZMGESDIBRGPF-YUSRRVBMSA-N |
| XLogP | 7.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|