C33H68O4Si3 — CID 25108331
(2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienal (PubChem CID 25108331) has the molecular formula C33H68O4Si3 and a molecular weight of 613.16 g/mol. Its IUPAC name is (2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienal.
| Compound Name | (2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienal |
|---|---|
| PubChem CID | 25108331 |
| Molecular Formula | C33H68O4Si3 |
| Molecular Weight | 613.16 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | (2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienal |
| SMILES | C=C/C=C\[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C[C@@H](C=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H68O4Si3/c1-14-24-25-28(11)32(36-39(18-5,19-6)20-7)30(13)33(37-40(21-8,22-9)23-10)29(12)26-31(27-34)35-38(15-2,16-3)17-4/h14,24-25,27-33H,1,15-23,26H2,2-13H3/b25-24-/t28-,29-,30-,31-,32-,33-/m0/s1 |
| InChIKey | UEUXUVJAWVDIMW-PSCSXFCXSA-N |
| XLogP | 10.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.16 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|