C34H70O4Si3 — CID 101490412
(3S,5S,6S,7R,8S,9S,10E)-5,7,9-trimethyl-3,6,8-tris(triethylsilyloxy)trideca-10,12-dien-2-one (PubChem CID 101490412) has the molecular formula C34H70O4Si3 and a molecular weight of 627.19 g/mol. Its IUPAC name is (3S,5S,6S,7R,8S,9S,10E)-5,7,9-trimethyl-3,6,8-tris(triethylsilyloxy)trideca-10,12-dien-2-one.
| Compound Name | (3S,5S,6S,7R,8S,9S,10E)-5,7,9-trimethyl-3,6,8-tris(triethylsilyloxy)trideca-10,12-dien-2-one |
|---|---|
| PubChem CID | 101490412 |
| Molecular Formula | C34H70O4Si3 |
| Molecular Weight | 627.19 g/mol |
| Exact Mass | 626.46 |
| IUPAC Name | (3S,5S,6S,7R,8S,9S,10E)-5,7,9-trimethyl-3,6,8-tris(triethylsilyloxy)trideca-10,12-dien-2-one |
| SMILES | C=C/C=C/[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C[C@H](O[Si](CC)(CC)CC)C(C)=O |
| InChI | InChI=1S/C34H70O4Si3/c1-15-25-26-28(11)33(37-40(19-5,20-6)21-7)30(13)34(38-41(22-8,23-9)24-10)29(12)27-32(31(14)35)36-39(16-2,17-3)18-4/h15,25-26,28-30,32-34H,1,16-24,27H2,2-14H3/b26-25+/t28-,29-,30-,32-,33-,34-/m0/s1 |
| InChIKey | NUZJJTNOXULNGV-WDYWMKPRSA-N |
| XLogP | 10.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.19 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|