C37H74O4Si3 — CID 134950439
(3Z,5S,6S,7R,9S,11Z,13S,14R,15S)-14,16-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-6-trimethylsilyloxyhexadeca-1,3,11-trien-8-one (PubChem CID 134950439) has the molecular formula C37H74O4Si3 and a molecular weight of 667.25 g/mol. Its IUPAC name is (3Z,5S,6S,7R,9S,11Z,13S,14R,15S)-14,16-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-6-trimethylsilyloxyhexadeca-1,3,11-trien-8-one.
| Compound Name | (3Z,5S,6S,7R,9S,11Z,13S,14R,15S)-14,16-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-6-trimethylsilyloxyhexadeca-1,3,11-trien-8-one |
|---|---|
| PubChem CID | 134950439 |
| Molecular Formula | C37H74O4Si3 |
| Molecular Weight | 667.25 g/mol |
| Exact Mass | 666.49 |
| IUPAC Name | (3Z,5S,6S,7R,9S,11Z,13S,14R,15S)-14,16-bis[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,11,13,15-hexamethyl-6-trimethylsilyloxyhexadeca-1,3,11-trien-8-one |
| SMILES | C=C/C=C\[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)C(=O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H74O4Si3/c1-21-22-23-28(3)35(40-42(14,15)16)32(7)33(38)29(4)24-27(2)25-30(5)34(41-44(19,20)37(11,12)13)31(6)26-39-43(17,18)36(8,9)10/h21-23,25,28-32,34-35H,1,24,26H2,2-20H3/b23-22-,27-25-/t28-,29-,30-,31-,32-,34+,35-/m0/s1 |
| InChIKey | YHCUMNHDTMUMAE-DCIQPTCMSA-N |
| XLogP | 11.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.25 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|