C33H63BrO2Si2 — CID 11422242
(3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-3,5,7,13-tetramethyl-15-trimethylsilyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one (PubChem CID 11422242) has the molecular formula C33H63BrO2Si2 and a molecular weight of 627.94 g/mol. Its IUPAC name is (3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-3,5,7,13-tetramethyl-15-trimethylsilyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one.
| Compound Name | (3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-3,5,7,13-tetramethyl-15-trimethylsilyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one |
|---|---|
| PubChem CID | 11422242 |
| Molecular Formula | C33H63BrO2Si2 |
| Molecular Weight | 627.94 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | (3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-3,5,7,13-tetramethyl-15-trimethylsilyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one |
| SMILES | CC/C(=C/[C@H](C)C/C=C/C(Br)=C/[C@@H](C)C(=O)[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)CC)[Si](C)(C)C |
| InChI | InChI=1S/C33H63BrO2Si2/c1-16-27(10)33(36-38(23(3)4,24(5)6)25(7)8)29(12)32(35)28(11)22-30(34)20-18-19-26(9)21-31(17-2)37(13,14)15/h18,20-29,33H,16-17,19H2,1-15H3/b20-18+,30-22-,31-21-/t26-,27+,28-,29-,33-/m1/s1 |
| InChIKey | TVWVZOQDNVUTCO-GUORHLKNSA-N |
| XLogP | 11.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.94 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|