C32H64O3Si2 — CID 10995240
(3S,4S,7S,9R,12E)-11-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-3,7,9-trimethyl-4-triethylsilyloxypentadeca-12,14-dien-2-one (PubChem CID 10995240) has the molecular formula C32H64O3Si2 and a molecular weight of 553.03 g/mol. Its IUPAC name is (3S,4S,7S,9R,12E)-11-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-3,7,9-trimethyl-4-triethylsilyloxypentadeca-12,14-dien-2-one.
| Compound Name | (3S,4S,7S,9R,12E)-11-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-3,7,9-trimethyl-4-triethylsilyloxypentadeca-12,14-dien-2-one |
|---|---|
| PubChem CID | 10995240 |
| Molecular Formula | C32H64O3Si2 |
| Molecular Weight | 553.03 g/mol |
| Exact Mass | 552.44 |
| IUPAC Name | (3S,4S,7S,9R,12E)-11-[tert-butyl(dimethyl)silyl]oxy-13-ethyl-3,7,9-trimethyl-4-triethylsilyloxypentadeca-12,14-dien-2-one |
| SMILES | C=C/C(=C/C(C[C@H](C)C[C@@H](C)CC[C@H](O[Si](CC)(CC)CC)[C@H](C)C(C)=O)O[Si](C)(C)C(C)(C)C)CC |
| InChI | InChI=1S/C32H64O3Si2/c1-15-29(16-2)24-30(34-36(13,14)32(10,11)12)23-26(7)22-25(6)20-21-31(27(8)28(9)33)35-37(17-3,18-4)19-5/h15,24-27,30-31H,1,16-23H2,2-14H3/b29-24-/t25-,26+,27+,30?,31-/m0/s1 |
| InChIKey | REWBIAZPBPPCSE-JUUSUXQYSA-N |
| XLogP | 10.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.03 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|