C20H36O3Si — CID 134973762
(8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxododeca-8,10-dienal (PubChem CID 134973762) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is (8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxododeca-8,10-dienal.
| Compound Name | (8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxododeca-8,10-dienal |
|---|---|
| PubChem CID | 134973762 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxododeca-8,10-dienal |
| SMILES | C/C=C/C=C/C(CC(=O)C(C)CC(C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O3Si/c1-9-10-11-12-18(23-24(7,8)20(4,5)6)14-19(22)17(3)13-16(2)15-21/h9-12,15-18H,13-14H2,1-8H3/b10-9+,12-11+ |
| InChIKey | MXGDGEGRBSBTBP-HULFFUFUSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|