C28H50O2Si — CID 91235240
(2S)-2-[(5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexan-1-one (PubChem CID 91235240) has the molecular formula C28H50O2Si and a molecular weight of 446.79 g/mol. Its IUPAC name is (2S)-2-[(5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexan-1-one.
| Compound Name | (2S)-2-[(5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 91235240 |
| Molecular Formula | C28H50O2Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (2S)-2-[(5R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-8,12-dimethyltrideca-1,3,11-trienyl]-2-methylcyclohexan-1-one |
| SMILES | CC(C)=CCC[C@H](C)CC[C@H](C=CC=C[C@]1(C)CCCCC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O2Si/c1-23(2)15-14-16-24(3)19-20-25(30-31(8,9)27(4,5)6)17-10-12-21-28(7)22-13-11-18-26(28)29/h10,12,15,17,21,24-25H,11,13-14,16,18-20,22H2,1-9H3/t24-,25-,28+/m0/s1 |
| InChIKey | UBYOHQPQIQUMRS-PNIUZAESSA-N |
| XLogP | 8.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|