C29H48O2Si — CID 134940859
(2S,3E,7E,11S,12S)-4,8,11,12-tetramethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one (PubChem CID 134940859) has the molecular formula C29H48O2Si and a molecular weight of 456.79 g/mol. Its IUPAC name is (2S,3E,7E,11S,12S)-4,8,11,12-tetramethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one.
| Compound Name | (2S,3E,7E,11S,12S)-4,8,11,12-tetramethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one |
|---|---|
| PubChem CID | 134940859 |
| Molecular Formula | C29H48O2Si |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | (2S,3E,7E,11S,12S)-4,8,11,12-tetramethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one |
| SMILES | C=C1C2=CC(=O)[C@@H](C)[C@]1(C)CC/C(C)=C/CC/C(C)=C/[C@@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H48O2Si/c1-19(2)32(20(3)4,21(5)6)31-28-17-23(8)14-12-13-22(7)15-16-29(11)24(9)26(28)18-27(30)25(29)10/h13,17-21,25,28H,9,12,14-16H2,1-8,10-11H3/b22-13+,23-17+/t25-,28+,29-/m1/s1 |
| InChIKey | XUMHCAVGVCYNHB-PWLSKPORSA-N |
| XLogP | 8.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|