C25H48O3Si — CID 16742608
2-[(2R,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]acetaldehyde (PubChem CID 16742608) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is 2-[(2R,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 16742608 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | 2-[(2R,3S,6S)-3-methyl-6-[(E,2S)-6-methyl-2-tri(propan-2-yl)silyloxyhept-3-enyl]oxan-2-yl]acetaldehyde |
| SMILES | CC(C)C/C=C/[C@H](C[C@@H]1CC[C@H](C)[C@@H](CC=O)O1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O3Si/c1-18(2)11-10-12-24(28-29(19(3)4,20(5)6)21(7)8)17-23-14-13-22(9)25(27-23)15-16-26/h10,12,16,18-25H,11,13-15,17H2,1-9H3/b12-10+/t22-,23-,24+,25+/m0/s1 |
| InChIKey | AJMUDFDNNZTRCX-ATIWNUJBSA-N |
| XLogP | 7.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|