C26H54O3Si2 — CID 102413098
(E,2S,3S,4R,5S,6S)-2,4,6,8-tetramethyl-3,5-bis(triethylsilyloxy)dec-8-enal (PubChem CID 102413098) has the molecular formula C26H54O3Si2 and a molecular weight of 470.89 g/mol. Its IUPAC name is (E,2S,3S,4R,5S,6S)-2,4,6,8-tetramethyl-3,5-bis(triethylsilyloxy)dec-8-enal.
| Compound Name | (E,2S,3S,4R,5S,6S)-2,4,6,8-tetramethyl-3,5-bis(triethylsilyloxy)dec-8-enal |
|---|---|
| PubChem CID | 102413098 |
| Molecular Formula | C26H54O3Si2 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | (E,2S,3S,4R,5S,6S)-2,4,6,8-tetramethyl-3,5-bis(triethylsilyloxy)dec-8-enal |
| SMILES | C/C=C(\C)C[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)C=O |
| InChI | InChI=1S/C26H54O3Si2/c1-12-21(8)19-22(9)25(28-30(13-2,14-3)15-4)24(11)26(23(10)20-27)29-31(16-5,17-6)18-7/h12,20,22-26H,13-19H2,1-11H3/b21-12+/t22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | YAFCSHPKVNBIEV-FCXXSKHESA-N |
| XLogP | 8.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|