C27H48O2Si — CID 57151335
(1S,2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-2-hepta-3,4-dienylcyclopent-3-ene-1-carbaldehyde (PubChem CID 57151335) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (1S,2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-2-hepta-3,4-dienylcyclopent-3-ene-1-carbaldehyde.
| Compound Name | (1S,2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-2-hepta-3,4-dienylcyclopent-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 57151335 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (1S,2R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-2-hepta-3,4-dienylcyclopent-3-ene-1-carbaldehyde |
| SMILES | CCC=C=CCC[C@H]1C(CC[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)=CC[C@@H]1C=O |
| InChI | InChI=1S/C27H48O2Si/c1-8-10-12-13-15-17-26-23(18-19-24(26)22-28)20-21-25(16-14-11-9-2)29-30(6,7)27(3,4)5/h10,13,18,22,24-26H,8-9,11,14-17,19-21H2,1-7H3/t12?,24-,25+,26+/m1/s1 |
| InChIKey | GOMMOZYHNRZHHH-JZCWUKPJSA-N |
| XLogP | 8.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|