C23H44O5 — CID 59958289
(Z)-3,5,11,13-tetramethoxy-2,4,6,8,10,12-hexamethyltridec-8-enal (PubChem CID 59958289) has the molecular formula C23H44O5 and a molecular weight of 400.60 g/mol. Its IUPAC name is (Z)-3,5,11,13-tetramethoxy-2,4,6,8,10,12-hexamethyltridec-8-enal.
| Compound Name | (Z)-3,5,11,13-tetramethoxy-2,4,6,8,10,12-hexamethyltridec-8-enal |
|---|---|
| PubChem CID | 59958289 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | (Z)-3,5,11,13-tetramethoxy-2,4,6,8,10,12-hexamethyltridec-8-enal |
| SMILES | COCC(C)C(OC)C(C)/C=C(/C)CC(C)C(OC)C(C)C(OC)C(C)C=O |
| InChI | InChI=1S/C23H44O5/c1-15(11-16(2)21(26-8)19(5)14-25-7)12-17(3)22(27-9)20(6)23(28-10)18(4)13-24/h11,13,16-23H,12,14H2,1-10H3/b15-11- |
| InChIKey | ZMHSSPGBELCUPI-PTNGSMBKSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|