C17H30O3 — CID 23630430
(2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-[(E,2S)-4-methylhex-4-en-2-yl]-1,3-dioxan-4-yl]propanal (PubChem CID 23630430) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-[(E,2S)-4-methylhex-4-en-2-yl]-1,3-dioxan-4-yl]propanal.
| Compound Name | (2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-[(E,2S)-4-methylhex-4-en-2-yl]-1,3-dioxan-4-yl]propanal |
|---|---|
| PubChem CID | 23630430 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (2S)-2-[(4R,5R,6S)-2,2,5-trimethyl-6-[(E,2S)-4-methylhex-4-en-2-yl]-1,3-dioxan-4-yl]propanal |
| SMILES | C/C=C(\C)C[C@H](C)[C@@H]1OC(C)(C)O[C@@H]([C@H](C)C=O)[C@@H]1C |
| InChI | InChI=1S/C17H30O3/c1-8-11(2)9-12(3)15-14(5)16(13(4)10-18)20-17(6,7)19-15/h8,10,12-16H,9H2,1-7H3/b11-8+/t12-,13+,14+,15-,16-/m0/s1 |
| InChIKey | ULEZAAKXOYRBOV-MBEXMBSWSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|