C23H38O2 — CID 11325456
2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]acetaldehyde (PubChem CID 11325456) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11325456 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 2-[(2R,5S)-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxan-2-yl]acetaldehyde |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@H]1CC[C@H](CC=O)OC1 |
| InChI | InChI=1S/C23H38O2/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-22-14-15-23(16-17-24)25-18-22/h8,10,12,17,22-23H,5-7,9,11,13-16,18H2,1-4H3/b20-10+,21-12+/t22-,23+/m0/s1 |
| InChIKey | LYUYHGXPBFLCOX-LXJWGMGSSA-N |
| XLogP | 6.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|