C15H24O2 — CID 91747472
2-[(5S)-5,8-dimethyl-2,3,4,5,5a,8,9,9a-octahydro-1-benzoxepin-2-yl]propanal (PubChem CID 91747472) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[(5S)-5,8-dimethyl-2,3,4,5,5a,8,9,9a-octahydro-1-benzoxepin-2-yl]propanal.
| Compound Name | 2-[(5S)-5,8-dimethyl-2,3,4,5,5a,8,9,9a-octahydro-1-benzoxepin-2-yl]propanal |
|---|---|
| PubChem CID | 91747472 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-[(5S)-5,8-dimethyl-2,3,4,5,5a,8,9,9a-octahydro-1-benzoxepin-2-yl]propanal |
| SMILES | CC1C=CC2C(C1)OC(C(C)C=O)CC[C@@H]2C |
| InChI | InChI=1S/C15H24O2/c1-10-4-6-13-11(2)5-7-14(12(3)9-16)17-15(13)8-10/h4,6,9-15H,5,7-8H2,1-3H3/t10?,11-,12?,13?,14?,15?/m0/s1 |
| InChIKey | HAICQTPYRLMCFN-ZOHUBXJXSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|