C14H20O2 — CID 163532269
4,4a,6,6a,7,8,9,10,10a,11a-decahydro-3H-benzo[c][1]benzoxepin-11-one (PubChem CID 163532269) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 4,4a,6,6a,7,8,9,10,10a,11a-decahydro-3H-benzo[c][1]benzoxepin-11-one.
| Compound Name | 4,4a,6,6a,7,8,9,10,10a,11a-decahydro-3H-benzo[c][1]benzoxepin-11-one |
|---|---|
| PubChem CID | 163532269 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 4,4a,6,6a,7,8,9,10,10a,11a-decahydro-3H-benzo[c][1]benzoxepin-11-one |
| SMILES | O=C1C2C=CCCC2OCC2CCCCC12 |
| InChI | InChI=1S/C14H20O2/c15-14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)14/h3,7,10-13H,1-2,4-6,8-9H2 |
| InChIKey | DTZBWLXORCIVEM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|