C17H24O2 — CID 140617704
3-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one (PubChem CID 140617704) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one.
| Compound Name | 3-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one |
|---|---|
| PubChem CID | 140617704 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one |
| SMILES | O=C1CCOC2C(CCC3C4CC=CC4CCC32)C1 |
| InChI | InChI=1S/C17H24O2/c18-13-8-9-19-17-12(10-13)5-6-15-14-3-1-2-11(14)4-7-16(15)17/h1-2,11-12,14-17H,3-10H2 |
| InChIKey | BPZCLXWWBLOUBN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|