C16H24O2 — CID 23281184
(1S,2S,6S,7S,14R)-2,7,14-trimethyl-10-oxatricyclo[5.4.3.01,6]tetradec-3-en-12-one (PubChem CID 23281184) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2S,6S,7S,14R)-2,7,14-trimethyl-10-oxatricyclo[5.4.3.01,6]tetradec-3-en-12-one.
| Compound Name | (1S,2S,6S,7S,14R)-2,7,14-trimethyl-10-oxatricyclo[5.4.3.01,6]tetradec-3-en-12-one |
|---|---|
| PubChem CID | 23281184 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,2S,6S,7S,14R)-2,7,14-trimethyl-10-oxatricyclo[5.4.3.01,6]tetradec-3-en-12-one |
| SMILES | C[C@@H]1CC(=O)[C@]23COCC[C@]1(C)[C@@H]2CC=C[C@@H]3C |
| InChI | InChI=1S/C16H24O2/c1-11-5-4-6-13-15(3)7-8-18-10-16(11,13)14(17)9-12(15)2/h4-5,11-13H,6-10H2,1-3H3/t11-,12+,13-,15-,16-/m0/s1 |
| InChIKey | BFCABVMKNDRCGL-AKIOZOGOSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|