C14H18O2 — CID 177410419
(1S,2S,7S,9R,10R,13S)-15-oxatetracyclo[7.4.1.110,13.02,7]pentadec-11-en-14-one (PubChem CID 177410419) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1S,2S,7S,9R,10R,13S)-15-oxatetracyclo[7.4.1.110,13.02,7]pentadec-11-en-14-one.
| Compound Name | (1S,2S,7S,9R,10R,13S)-15-oxatetracyclo[7.4.1.110,13.02,7]pentadec-11-en-14-one |
|---|---|
| PubChem CID | 177410419 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1S,2S,7S,9R,10R,13S)-15-oxatetracyclo[7.4.1.110,13.02,7]pentadec-11-en-14-one |
| SMILES | O=C1[C@H]2[C@H]3CCCC[C@H]3C[C@@H]1[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C14H18O2/c15-14-10-7-8-3-1-2-4-9(8)13(14)12-6-5-11(10)16-12/h5-6,8-13H,1-4,7H2/t8-,9-,10+,11+,12-,13-/m0/s1 |
| InChIKey | DNZIDEQRJLBLNO-ZJJIEKDWSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|