C15H22O3 — CID 139590438
(4aS,6aR,8S,10aS,10bR)-8-(hydroxymethyl)-4a-methyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one (PubChem CID 139590438) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4aS,6aR,8S,10aS,10bR)-8-(hydroxymethyl)-4a-methyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one.
| Compound Name | (4aS,6aR,8S,10aS,10bR)-8-(hydroxymethyl)-4a-methyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 139590438 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4aS,6aR,8S,10aS,10bR)-8-(hydroxymethyl)-4a-methyl-3,6a,7,8,9,10,10a,10b-octahydro-2H-benzo[f]chromen-1-one |
| SMILES | C[C@]12C=C[C@H]3C[C@@H](CO)CC[C@@H]3[C@H]1C(=O)CCO2 |
| InChI | InChI=1S/C15H22O3/c1-15-6-4-11-8-10(9-16)2-3-12(11)14(15)13(17)5-7-18-15/h4,6,10-12,14,16H,2-3,5,7-9H2,1H3/t10-,11-,12-,14-,15-/m0/s1 |
| InChIKey | OXHAAEYTFFZWEJ-YLXLXVFQSA-N |
| XLogP | 1.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|