C17H22O2 — CID 91440841
1,3,4,4a,4b,5,6,6a,7,9,10,10a-dodecahydronaphtho[2,1-f]isochromen-8-one (PubChem CID 91440841) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1,3,4,4a,4b,5,6,6a,7,9,10,10a-dodecahydronaphtho[2,1-f]isochromen-8-one.
| Compound Name | 1,3,4,4a,4b,5,6,6a,7,9,10,10a-dodecahydronaphtho[2,1-f]isochromen-8-one |
|---|---|
| PubChem CID | 91440841 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1,3,4,4a,4b,5,6,6a,7,9,10,10a-dodecahydronaphtho[2,1-f]isochromen-8-one |
| SMILES | O=C1CCC2C3=CC=C4COCCC4C3CCC2C1 |
| InChI | InChI=1S/C17H22O2/c18-13-3-6-14-11(9-13)1-4-17-15-7-8-19-10-12(15)2-5-16(14)17/h2,5,11,14-15,17H,1,3-4,6-10H2 |
| InChIKey | ZHEHAFHBGMNFSK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |