C25H38O2 — CID 12783257
(4aS,4bS,6aS,10aS,10bS)-4a,6a-dimethyl-7-pentoxy-4,4b,5,6,7,10,10a,10b,11,12-decahydro-3H-chrysen-2-one (PubChem CID 12783257) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (4aS,4bS,6aS,10aS,10bS)-4a,6a-dimethyl-7-pentoxy-4,4b,5,6,7,10,10a,10b,11,12-decahydro-3H-chrysen-2-one.
| Compound Name | (4aS,4bS,6aS,10aS,10bS)-4a,6a-dimethyl-7-pentoxy-4,4b,5,6,7,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
|---|---|
| PubChem CID | 12783257 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (4aS,4bS,6aS,10aS,10bS)-4a,6a-dimethyl-7-pentoxy-4,4b,5,6,7,10,10a,10b,11,12-decahydro-3H-chrysen-2-one |
| SMILES | CCCCCOC1C=CC[C@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38O2/c1-4-5-6-16-27-23-9-7-8-21-20-11-10-18-17-19(26)12-14-24(18,2)22(20)13-15-25(21,23)3/h7,9,17,20-23H,4-6,8,10-16H2,1-3H3/t20-,21+,22+,23?,24-,25+/m1/s1 |
| InChIKey | NUCGLWVWZABNHA-GHONCLJSSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|