C20H32O3 — CID 14138927
(2R)-2-[(2R,5Z)-5-[(E)-6-hydroxy-4-methylhex-4-enylidene]oxan-2-yl]-6-methylhept-5-enal (PubChem CID 14138927) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2R)-2-[(2R,5Z)-5-[(E)-6-hydroxy-4-methylhex-4-enylidene]oxan-2-yl]-6-methylhept-5-enal.
| Compound Name | (2R)-2-[(2R,5Z)-5-[(E)-6-hydroxy-4-methylhex-4-enylidene]oxan-2-yl]-6-methylhept-5-enal |
|---|---|
| PubChem CID | 14138927 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2R)-2-[(2R,5Z)-5-[(E)-6-hydroxy-4-methylhex-4-enylidene]oxan-2-yl]-6-methylhept-5-enal |
| SMILES | CC(C)=CCC[C@@H](C=O)[C@H]1CC/C(=C/CC/C(C)=C/CO)CO1 |
| InChI | InChI=1S/C20H32O3/c1-16(2)6-4-9-19(14-22)20-11-10-18(15-23-20)8-5-7-17(3)12-13-21/h6,8,12,14,19-21H,4-5,7,9-11,13,15H2,1-3H3/b17-12+,18-8-/t19-,20+/m0/s1 |
| InChIKey | UCKHUGXNJNCONK-UTQGQJBBSA-N |
| XLogP | 4.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|