C16H28O3 — CID 23249723
2-(2,2-dimethyl-1,3-dioxan-4-yl)-2,7-dimethyloct-6-en-3-one (PubChem CID 23249723) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2,7-dimethyloct-6-en-3-one.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2,7-dimethyloct-6-en-3-one |
|---|---|
| PubChem CID | 23249723 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxan-4-yl)-2,7-dimethyloct-6-en-3-one |
| SMILES | CC(C)=CCCC(=O)C(C)(C)C1CCOC(C)(C)O1 |
| InChI | InChI=1S/C16H28O3/c1-12(2)8-7-9-13(17)15(3,4)14-10-11-18-16(5,6)19-14/h8,14H,7,9-11H2,1-6H3 |
| InChIKey | DBHUEFRTBQKBKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|