C16H28O3 — CID 11119104
2-[(2S,4S,6S)-2-methyl-6-(7-methyloct-6-enyl)-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 11119104) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[(2S,4S,6S)-2-methyl-6-(7-methyloct-6-enyl)-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2S,4S,6S)-2-methyl-6-(7-methyloct-6-enyl)-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11119104 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-[(2S,4S,6S)-2-methyl-6-(7-methyloct-6-enyl)-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CC(C)=CCCCCC[C@H]1C[C@@H](CC=O)O[C@@H](C)O1 |
| InChI | InChI=1S/C16H28O3/c1-13(2)8-6-4-5-7-9-15-12-16(10-11-17)19-14(3)18-15/h8,11,14-16H,4-7,9-10,12H2,1-3H3/t14-,15-,16+/m0/s1 |
| InChIKey | CKVVKKWYBJNCGC-HRCADAONSA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|