C21H36O6 — CID 11153340
[(E,3S,4R,6R,7S,8R,9S)-4-acetyloxy-3-formyl-8-methoxy-7,9-dimethyltridec-11-en-6-yl] acetate (PubChem CID 11153340) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is [(E,3S,4R,6R,7S,8R,9S)-4-acetyloxy-3-formyl-8-methoxy-7,9-dimethyltridec-11-en-6-yl] acetate.
| Compound Name | [(E,3S,4R,6R,7S,8R,9S)-4-acetyloxy-3-formyl-8-methoxy-7,9-dimethyltridec-11-en-6-yl] acetate |
|---|---|
| PubChem CID | 11153340 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | [(E,3S,4R,6R,7S,8R,9S)-4-acetyloxy-3-formyl-8-methoxy-7,9-dimethyltridec-11-en-6-yl] acetate |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@@H](OC(C)=O)[C@@H](C=O)CC)OC(C)=O |
| InChI | InChI=1S/C21H36O6/c1-8-10-11-14(3)21(25-7)15(4)19(26-16(5)23)12-20(27-17(6)24)18(9-2)13-22/h8,10,13-15,18-21H,9,11-12H2,1-7H3/b10-8+/t14-,15-,18+,19+,20+,21+/m0/s1 |
| InChIKey | UPUZLHGCSGKGLY-KFDWVXDBSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|