C27H42O7 — CID 13066527
[(4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-acetyloxy-7,16-diethyl-5,9,13,15-tetramethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-4-yl] acetate (PubChem CID 13066527) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is [(4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-acetyloxy-7,16-diethyl-5,9,13,15-tetramethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-4-yl] acetate.
| Compound Name | [(4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-acetyloxy-7,16-diethyl-5,9,13,15-tetramethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-4-yl] acetate |
|---|---|
| PubChem CID | 13066527 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [(4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-acetyloxy-7,16-diethyl-5,9,13,15-tetramethyl-2,10-dioxo-1-oxacyclohexadeca-11,13-dien-4-yl] acetate |
| SMILES | CC[C@@H]1C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H](C)[C@@H](CC)OC(=O)C[C@@H](OC(C)=O)[C@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H42O7/c1-9-22-14-17(4)23(30)12-11-16(3)13-18(5)24(10-2)34-26(31)15-25(32-20(7)28)19(6)27(22)33-21(8)29/h11-13,17-19,22,24-25,27H,9-10,14-15H2,1-8H3/b12-11+,16-13+/t17-,18-,19+,22-,24-,25-,27-/m1/s1 |
| InChIKey | XHCJBECRRYJDIJ-AANZBURSSA-N |
| XLogP | 4.97 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|