C16H28O3 — CID 11974507
(3S,4S)-3-hexyl-4-[(E,2R)-2-hydroxyhept-5-enyl]oxetan-2-one (PubChem CID 11974507) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3S,4S)-3-hexyl-4-[(E,2R)-2-hydroxyhept-5-enyl]oxetan-2-one.
| Compound Name | (3S,4S)-3-hexyl-4-[(E,2R)-2-hydroxyhept-5-enyl]oxetan-2-one |
|---|---|
| PubChem CID | 11974507 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (3S,4S)-3-hexyl-4-[(E,2R)-2-hydroxyhept-5-enyl]oxetan-2-one |
| SMILES | C/C=C/CC[C@@H](O)C[C@@H]1OC(=O)[C@H]1CCCCCC |
| InChI | InChI=1S/C16H28O3/c1-3-5-7-9-11-14-15(19-16(14)18)12-13(17)10-8-6-4-2/h4,6,13-15,17H,3,5,7-12H2,1-2H3/b6-4+/t13-,14+,15+/m1/s1 |
| InChIKey | RSESPNOVLBYCOC-UUFAANBYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|