C21H34O5 — CID 91157319
10-hydroxy-5-(hydroxymethyl)-2,13-dimethyl-7-(2-methylpropanoyl)tetradeca-2,12-diene-6,8-dione (PubChem CID 91157319) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 10-hydroxy-5-(hydroxymethyl)-2,13-dimethyl-7-(2-methylpropanoyl)tetradeca-2,12-diene-6,8-dione.
| Compound Name | 10-hydroxy-5-(hydroxymethyl)-2,13-dimethyl-7-(2-methylpropanoyl)tetradeca-2,12-diene-6,8-dione |
|---|---|
| PubChem CID | 91157319 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 10-hydroxy-5-(hydroxymethyl)-2,13-dimethyl-7-(2-methylpropanoyl)tetradeca-2,12-diene-6,8-dione |
| SMILES | CC(C)=CCC(O)CC(=O)C(C(=O)C(C)C)C(=O)C(CO)CC=C(C)C |
| InChI | InChI=1S/C21H34O5/c1-13(2)7-9-16(12-22)21(26)19(20(25)15(5)6)18(24)11-17(23)10-8-14(3)4/h7-8,15-17,19,22-23H,9-12H2,1-6H3 |
| InChIKey | PBXDMNVBRHGFNS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|